CAS 2288710-66-5 appears in our catalog under these names: (4–(4–Methylthiazol–5–yl)phenyl)methanamine hydrochloride, (4-(4-Methylthiazol-5-yl)phenyl)methanamine hydrochloride 97%, (4-(4-Methylthiazol-5-yl)phenyl)methanamine hydrochloride, 98%, 98%, (4-(4-Methylthiazol-5-yl)phenyl)methanamine hydrochloride, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride (CAS 2288710-66-5) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride. InChIKey: LPTNIIRGFCUEJT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride |
| InChIKey | LPTNIIRGFCUEJT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)