Products 1027818-05-8
CAS 1027818-05-8 is the registry number for Fumaric Acid Monomethyl Ester-13C4. Offered by: TRC. Available pack sizes: 5mg.
(E)-4-methoxy-4-oxo(1,2,3,4-13C4)but-2-enoic acid (CAS 1027818-05-8) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 134.07 g/mol. IUPAC name: (E)-4-methoxy-4-oxo(1,2,3,4-13C4)but-2-enoic acid. InChIKey: NKHAVTQWNUWKEO-SMTGNBPNSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 134.07 g/mol |
| IUPAC name | (E)-4-methoxy-4-oxo(1,2,3,4-13C4)but-2-enoic acid |
| InChIKey | NKHAVTQWNUWKEO-SMTGNBPNSA-N |
| SMILES | CO[13C](=O)/[13CH]=[13CH]/[13C](=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fumaric Acid Monomethyl Ester-13C4