Products 1616345-41-5
CAS 1616345-41-5 appears in our catalog under these names: Monomethyl fumarate–d3, Monomethyl Fumarate-d3, Fumaric Acid Monomethyl Ester-d3, >95% (HPLC), Monomethyl fumarate-d3, 99.01%. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: 5mg, on request, 100mg, 10mg, 1mg, 5 mg, 1 mg.
(E)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid (CAS 1616345-41-5) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 133.12 g/mol. IUPAC name: (E)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid. InChIKey: NKHAVTQWNUWKEO-SMQGVBCRSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (E)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid |
| InChIKey | NKHAVTQWNUWKEO-SMQGVBCRSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)