Products 1266402-66-7
CAS 1266402-66-7 appears in our catalog under these names: (2Z)-2-Butenedioic Acid 1-Methyl Ester-d3, (Z)-4-(Methoxy-d3)-4-oxobut-2-enoic acid. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
(Z)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid (CAS 1266402-66-7) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 133.12 g/mol. IUPAC name: (Z)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid. InChIKey: NKHAVTQWNUWKEO-CZENPIIFSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (Z)-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid |
| InChIKey | NKHAVTQWNUWKEO-CZENPIIFSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)