Products 1616345-45-9
CAS 1616345-45-9 appears in our catalog under these names: Monomethyl Fumarate-d5, Fumaric Acid Monomethyl Ester-d5, >95% (HPLC), Fumaric acid monomethyl ester-d5. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 1 mg, 5 mg.
(E)-2,3-dideuterio-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid (CAS 1616345-45-9) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 135.13 g/mol. IUPAC name: (E)-2,3-dideuterio-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid. InChIKey: NKHAVTQWNUWKEO-PWYLTMEHSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 135.13 g/mol |
| IUPAC name | (E)-2,3-dideuterio-4-oxo-4-(trideuteriomethoxy)but-2-enoic acid |
| InChIKey | NKHAVTQWNUWKEO-PWYLTMEHSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)OC([2H])([2H])[2H])/C(=O)O |
Computed by PubChem (NCBI)