Products 253122-44-0
CAS 253122-44-0 is the registry number for Monomethyl fumarate-d2, 98.2%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(E)-2,3-dideuterio-4-methoxy-4-oxobut-2-enoic acid (CAS 253122-44-0) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 132.11 g/mol. IUPAC name: (E)-2,3-dideuterio-4-methoxy-4-oxobut-2-enoic acid. InChIKey: NKHAVTQWNUWKEO-XNHULNRKSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 132.11 g/mol |
| IUPAC name | (E)-2,3-dideuterio-4-methoxy-4-oxobut-2-enoic acid |
| InChIKey | NKHAVTQWNUWKEO-XNHULNRKSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)OC)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Monomethyl fumarate-d2, orb3136370