CAS 102822-66-2 is the registry number for Mannostatin B. Offered by: TRC. Available pack sizes: 75mg.
(1R,2R,3R,4S,5R)-4-amino-5-[(S)-methylsulfinyl]cyclopentane-1,2,3-triol (CAS 102822-66-2) is a chemical compound with the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. IUPAC name: (1R,2R,3R,4S,5R)-4-amino-5-[(S)-methylsulfinyl]cyclopentane-1,2,3-triol. InChIKey: ZJFKRRRXLLAUHQ-VQZGLSRDSA-N.
| Molecular formula | C6H13NO4S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (1R,2R,3R,4S,5R)-4-amino-5-[(S)-methylsulfinyl]cyclopentane-1,2,3-triol |
| InChIKey | ZJFKRRRXLLAUHQ-VQZGLSRDSA-N |
| SMILES | C[S@](=O)[C@@H]1[C@H]([C@H]([C@H]([C@H]1O)O)O)N |
Computed by PubChem (NCBI)