Products 181124-14-1
CAS 181124-14-1 is the registry number for (S)-3-(N,N-Dimethylsulfamoyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(dimethylsulfamoyl)-2-methylpropanoic acid (CAS 181124-14-1) is a chemical compound with the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. IUPAC name: (2S)-3-(dimethylsulfamoyl)-2-methylpropanoic acid. InChIKey: IXDKJVCZEWSRKI-RXMQYKEDSA-N.
| Molecular formula | C6H13NO4S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (2S)-3-(dimethylsulfamoyl)-2-methylpropanoic acid |
| InChIKey | IXDKJVCZEWSRKI-RXMQYKEDSA-N |
| SMILES | C[C@H](CS(=O)(=O)N(C)C)C(=O)O |
Computed by PubChem (NCBI)