CAS 97482-31-0 is the registry number for (2S)-2-Methanesulfonamido-3-methylbutanoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 0,5g.
(2S)-2-(methanesulfonamido)-3-methylbutanoic acid (CAS 97482-31-0) is a chemical compound with the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. IUPAC name: (2S)-2-(methanesulfonamido)-3-methylbutanoic acid. InChIKey: AKFZJYZYVABSGC-YFKPBYRVSA-N.
| Molecular formula | C6H13NO4S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (2S)-2-(methanesulfonamido)-3-methylbutanoic acid |
| InChIKey | AKFZJYZYVABSGC-YFKPBYRVSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C |
Computed by PubChem (NCBI)