Products 209665-22-5
CAS 209665-22-5 appears in our catalog under these names: Fudosteine Impurity A；Fudosteine Sulfoxide, Fudosteine EP Impurity C, Fudosteine Impurity 3（Fudosteine Sulfoxide Trifluoroacetate）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-amino-3-(3-hydroxypropylsulfinyl)propanoic acid (CAS 209665-22-5) is a chemical compound with the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. IUPAC name: (2R)-2-amino-3-(3-hydroxypropylsulfinyl)propanoic acid. InChIKey: JKLZQOWIWNYTTI-XHBICQFHSA-N.
| Molecular formula | C6H13NO4S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-hydroxypropylsulfinyl)propanoic acid |
| InChIKey | JKLZQOWIWNYTTI-XHBICQFHSA-N |
| SMILES | C(CO)CS(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)