CAS 1519652-84-6 appears in our catalog under these names: Methyl 2,2-dimethyl-3-sulfamoylpropanoate, 95%, Methyl 2,2-dimethyl-3-sulfamoylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2,2-dimethyl-3-sulfamoylpropanoate (CAS 1519652-84-6) is a chemical compound with the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. IUPAC name: methyl 2,2-dimethyl-3-sulfamoylpropanoate. InChIKey: LOYLDEPDLDBLIQ-UHFFFAOYSA-N.
| Molecular formula | C6H13NO4S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | methyl 2,2-dimethyl-3-sulfamoylpropanoate |
| InChIKey | LOYLDEPDLDBLIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(CS(=O)(=O)N)C(=O)OC |
Computed by PubChem (NCBI)