Products 1028666-38-7

CAS 1028666-38-7 is the registry number for 2-(3,4-Dihydro-1H-2-benzopyran-7-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(3,4-dihydro-1H-isochromen-7-yl)acetic acid (CAS 1028666-38-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2-(3,4-dihydro-1H-isochromen-7-yl)acetic acid. InChIKey: MIRGTQSHXBYBJF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name2-(3,4-dihydro-1H-isochromen-7-yl)acetic acid
InChIKeyMIRGTQSHXBYBJF-UHFFFAOYSA-N
SMILESC1COCC2=C1C=CC(=C2)CC(=O)O

Computed by PubChem (NCBI)