CAS 102932-05-8 is the registry number for 4-Bromo-2-chlorophenyl acetate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-bromo-2-chlorophenyl) acetate (CAS 102932-05-8) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: (4-bromo-2-chlorophenyl) acetate. InChIKey: RWPCQJOZQXSJGQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | (4-bromo-2-chlorophenyl) acetate |
| InChIKey | RWPCQJOZQXSJGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)