CAS 102936-05-0 appears in our catalog under these names: (S)-2-((Phenylcarbamoyl)oxy)propanoic acid, 95%, (S)–(–)–2–(Phenylcarbamoyloxy)propionic acid, (S)-2-((Phenylcarbamoyl)oxy)propanoic acid, 98%, 98%, (S)-2-((Phenylcarbamoyl)oxy)propanoic acid, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100g, 25g, 5g, 100mg, 10g.
(2S)-2-(phenylcarbamoyloxy)propanoic acid (CAS 102936-05-0) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2S)-2-(phenylcarbamoyloxy)propanoic acid. InChIKey: HYIHYWQSOXTJFS-ZETCQYMHSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2S)-2-(phenylcarbamoyloxy)propanoic acid |
| InChIKey | HYIHYWQSOXTJFS-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)OC(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)