CAS 1029432-03-8 is the registry number for 4-(tert-Butoxycarbonyl)thiazole-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-2-carboxylic acid (CAS 1029432-03-8) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-2-carboxylic acid. InChIKey: HXSOUSOCQNWIQP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazole-2-carboxylic acid |
| InChIKey | HXSOUSOCQNWIQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CSC(=N1)C(=O)O |
Computed by PubChem (NCBI)