CAS 1029612-16-5 is the registry number for (2E)-3-(((4-Methylphenyl)sulfonyl)oxy)-2-butenoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
Methyl (E)-3-(4-methylphenyl)sulfonyloxybut-2-enoate (CAS 1029612-16-5) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: methyl (E)-3-(4-methylphenyl)sulfonyloxybut-2-enoate. InChIKey: QBENOPMVGLDWSB-CSKARUKUSA-N.
| Molecular formula | C12H14O5S |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | methyl (E)-3-(4-methylphenyl)sulfonyloxybut-2-enoate |
| InChIKey | QBENOPMVGLDWSB-CSKARUKUSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O/C(=C/C(=O)OC)/C |
Computed by PubChem (NCBI)