CAS 58879-34-8 appears in our catalog under these names: (S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate, 95+%, (S)-(+)-Dihydro-5-(p-tolylsulfonyloxymethyl)-2(3H)-furanone, 98%, 98%, (S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate, ≥98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
[(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (CAS 58879-34-8) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: MGAXYKDBRBNWKT-JTQLQIEISA-N.
| Molecular formula | C12H14O5S |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | [(2S)-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | MGAXYKDBRBNWKT-JTQLQIEISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2CCC(=O)O2 |
Computed by PubChem (NCBI)