CAS 107971-34-6 is the registry number for (5-Oxooxolan-2-yl)methyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate (CAS 107971-34-6) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate. InChIKey: MGAXYKDBRBNWKT-UHFFFAOYSA-N.
| Molecular formula | C12H14O5S |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | MGAXYKDBRBNWKT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCC(=O)O2 |
Computed by PubChem (NCBI)