Products 1306603-69-9

CAS 1306603-69-9 is the registry number for 2-((5-Acetyl-2-methoxyphenyl)methanesulfinyl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid (CAS 1306603-69-9) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: 2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid. InChIKey: HJHNGCDQLJERJO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O5S
Molecular weight270.30 g/mol
IUPAC name2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid
InChIKeyHJHNGCDQLJERJO-UHFFFAOYSA-N
SMILESCC(=O)C1=CC(=C(C=C1)OC)CS(=O)CC(=O)O

Computed by PubChem (NCBI)