CAS 1306603-69-9 is the registry number for 2-((5-Acetyl-2-methoxyphenyl)methanesulfinyl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid (CAS 1306603-69-9) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: 2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid. InChIKey: HJHNGCDQLJERJO-UHFFFAOYSA-N.
| Molecular formula | C12H14O5S |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | 2-[(5-acetyl-2-methoxyphenyl)methylsulfinyl]acetic acid |
| InChIKey | HJHNGCDQLJERJO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)CS(=O)CC(=O)O |
Computed by PubChem (NCBI)