CAS 1672665-62-1 is the registry number for 7-(Methylsulfonyl)-2,3-dihydrospiro[indene-1,2'-[1,3]dioxolan]-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7'-methylsulfonylspiro[1,3-dioxolane-2,1'-2,3-dihydroindene]-4'-ol (CAS 1672665-62-1) is a chemical compound with the molecular formula C12H14O5S and a molecular weight of 270.30 g/mol. IUPAC name: 7'-methylsulfonylspiro[1,3-dioxolane-2,1'-2,3-dihydroindene]-4'-ol. InChIKey: PJSAETRCYAMYDG-UHFFFAOYSA-N.
| Molecular formula | C12H14O5S |
|---|---|
| Molecular weight | 270.30 g/mol |
| IUPAC name | 7'-methylsulfonylspiro[1,3-dioxolane-2,1'-2,3-dihydroindene]-4'-ol |
| InChIKey | PJSAETRCYAMYDG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C2C(=C(C=C1)O)CCC23OCCO3 |
Computed by PubChem (NCBI)