CAS 1224884-77-8 is the registry number for 2-(2,5-Dichlorophenyl)-5-methyl-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-dichlorophenyl)-5-methyl-1H-imidazole (CAS 1224884-77-8) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-5-methyl-1H-imidazole. InChIKey: DKQLXUCBNHKRGR-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-5-methyl-1H-imidazole |
| InChIKey | DKQLXUCBNHKRGR-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)