Products 103-40-2
CAS 103-40-2 appears in our catalog under these names: Succinic Acid Monobenzyl Ester, 4-(Benzyloxy)-4-oxobutanoic Acid, >98.0%(HPLC)(T), 4-(Benzyloxy)-4-oxobutanoic acid 97%, Butanedioic acid, 1-(phenylmethyl) ester, 97%, 97%, 4-(Benzyloxy)-4-oxobutanoic acid, 99.87%. Offered by: TRC, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 5g, 25g, 250mg, 1g, 10g.
4-oxo-4-phenylmethoxybutanoic acid (CAS 103-40-2) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-oxo-4-phenylmethoxybutanoic acid. InChIKey: UGUBQKZSNQWWEV-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | UGUBQKZSNQWWEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)O |
Computed by PubChem (NCBI)