CAS 103026-83-1 appears in our catalog under these names: Nisoldipine Impurity C, Dehydro Nisoldipine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 50mg, 5mg.
5-O-methyl 3-O-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 103026-83-1) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: 5-O-methyl 3-O-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: PCNPLNDGLOCZGS-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 5-O-methyl 3-O-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | PCNPLNDGLOCZGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OCC(C)C)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)