CAS 7535-56-0 appears in our catalog under these names: Boc-Phe-ONP, 98%, 4-Nitrophenyl (2S)-2-(tert-Butoxycarbonylamino)-3-phenylpropanoate (N-BOC-L-Phenylalanine 4-Nitrophenyl Ester), Boc–Phe–ONp, Boc-L-Phe-ONp, Boc-Phe-ONp, 98%, 98%. Offered by: Combi-blocks, Mikromol, GLPBio, Iris Biotech, Chemat. Available pack sizes: 100g, 500g, 25g, 5g, 25mg, 10g, 10 g, 5 g.
(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 7535-56-0) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: QZIWWFMMLBBICG-KRWDZBQOSA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | QZIWWFMMLBBICG-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)