CAS 16159-70-9 appears in our catalog under these names: Boc–D–Phe–ONp, Boc-D-Phe-ONp, Boc-D-Phe-ONp, 98%, 98%, (R)-4-Nitrophenyl 2-((tert-butoxycarbonyl)amino)-3-phenylpropanoate, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
(4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 16159-70-9) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: (4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: QZIWWFMMLBBICG-QGZVFWFLSA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | QZIWWFMMLBBICG-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)