CAS 24181-97-3 is the registry number for Z-L-Nle-ONp. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.
(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)hexanoate (CAS 24181-97-3) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: UFQPOFZGPUCSGU-SFHVURJKSA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | UFQPOFZGPUCSGU-SFHVURJKSA-N |
| SMILES | CCCC[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)