CAS 2130-99-6 appears in our catalog under these names: Z-Ile-onp, 95%, Z–Ile–ONp, Z-Ile-ONp 95%, Z-Ile-ONp, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g.
(4-nitrophenyl) (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (CAS 2130-99-6) is a chemical compound with the molecular formula C20H22N2O6 and a molecular weight of 386.4 g/mol. IUPAC name: (4-nitrophenyl) (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate. InChIKey: NJDZCCJYUBNBMK-KSSFIOAISA-N.
| Molecular formula | C20H22N2O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | NJDZCCJYUBNBMK-KSSFIOAISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)