CAS 1030313-53-1 appears in our catalog under these names: (2–Fluoro–4–(trifluoromethyl)phenyl)hydrazine hydrochloride, (2-Fluoro-4-(trifluoromethyl)phenyl)hydrazine hydrochloride, 95%, 95%, 2-Fluoro-4-(trifluoromethyl)phenylhydrazine hydrochloride, 97%, (2-Fluoro-4-(trifluoromethyl)phenyl)hydrazine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[2-fluoro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 1030313-53-1) is a chemical compound with the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. IUPAC name: [2-fluoro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: MKEPKMONQVYQDR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF4N2 |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | [2-fluoro-4-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | MKEPKMONQVYQDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)NN.Cl |
Computed by PubChem (NCBI)