CAS 502496-21-1 appears in our catalog under these names: (4–Fluoro–2–(trifluoromethyl)phenyl)hydrazine hydrochloride, (4-Fluoro-2-(trifluoromethyl)phenyl)hydrazine hydrochloride, 97%, 97%, (4-Fluoro-2-(trifluoromethyl)phenyl)hydrazine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[4-fluoro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 502496-21-1) is a chemical compound with the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. IUPAC name: [4-fluoro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: LNQZKXJBQIKMPS-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF4N2 |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | [4-fluoro-2-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | LNQZKXJBQIKMPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)