CAS 502496-22-2 appears in our catalog under these names: 4-Fluoro-3-(trifluoromethyl)phenylhydrazine hydrochloride, 97%, 97%, 4-FLUORO-3-(TRIFLUOROMETHYL)PHENYLHYDRAZINE HCL, 97%, 4-Fluoro-3-(trifluoromethyl)phenylhydrazine hydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g.
[4-fluoro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 502496-22-2) is a chemical compound with the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. IUPAC name: [4-fluoro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: KBJZDPPQFFSNDS-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF4N2 |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | [4-fluoro-3-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | KBJZDPPQFFSNDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)