CAS 2375262-15-8 is the registry number for 5-(1,2,2,2-Tetrafluoroethyl)pyridin-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1,2,2,2-tetrafluoroethyl)pyridin-2-amine;hydrochloride (CAS 2375262-15-8) is a chemical compound with the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. IUPAC name: 5-(1,2,2,2-tetrafluoroethyl)pyridin-2-amine;hydrochloride. InChIKey: LNMORQLLIQGQLN-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF4N2 |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 5-(1,2,2,2-tetrafluoroethyl)pyridin-2-amine;hydrochloride |
| InChIKey | LNMORQLLIQGQLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(C(F)(F)F)F)N.Cl |
Computed by PubChem (NCBI)