CAS 2204040-55-9 is the registry number for (3-Fluoro-5-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride (CAS 2204040-55-9) is a chemical compound with the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. IUPAC name: [3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride. InChIKey: UNPIEHUHXSAZBN-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF4N2 |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | [3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | UNPIEHUHXSAZBN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)