Products 103038-00-2
CAS 103038-00-2 is the registry number for Ethyl 5-cyano-2-methylnicotinate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 5-cyano-2-methylpyridine-3-carboxylate (CAS 103038-00-2) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: ethyl 5-cyano-2-methylpyridine-3-carboxylate. InChIKey: NEJOOOQDGVMSFX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | ethyl 5-cyano-2-methylpyridine-3-carboxylate |
| InChIKey | NEJOOOQDGVMSFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)C#N)C |
Computed by PubChem (NCBI)