Products 1030513-69-9
CAS 1030513-69-9 is the registry number for 5-(Propan-2-yl)-1,3-benzoxazol-2-amine. Offered by: Biosynth. Available pack sizes: 5g.
5-propan-2-yl-1,3-benzoxazol-2-amine (CAS 1030513-69-9) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 5-propan-2-yl-1,3-benzoxazol-2-amine. InChIKey: PGWHHIUTOAJRHW-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 5-propan-2-yl-1,3-benzoxazol-2-amine |
| InChIKey | PGWHHIUTOAJRHW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)OC(=N2)N |
Computed by PubChem (NCBI)