CAS 1031072-43-1 is the registry number for N-(4-Cyanophenyl)-4-ethyl-1,2,3-thiadiazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-cyanophenyl)-4-ethylthiadiazole-5-carboxamide (CAS 1031072-43-1) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: N-(4-cyanophenyl)-4-ethylthiadiazole-5-carboxamide. InChIKey: LJSDFMLUSZTKGL-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | N-(4-cyanophenyl)-4-ethylthiadiazole-5-carboxamide |
| InChIKey | LJSDFMLUSZTKGL-UHFFFAOYSA-N |
| SMILES | CCC1=C(SN=N1)C(=O)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)