CAS 785705-81-9 is the registry number for 2-([1,2,4]Triazolo[4,3-a]pyridin-3-ylthio)-1-(1H-pyrrol-2-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1H-pyrrol-2-yl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanone (CAS 785705-81-9) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 1-(1H-pyrrol-2-yl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanone. InChIKey: AMFWLCNKAVIQGF-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-(1H-pyrrol-2-yl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanone |
| InChIKey | AMFWLCNKAVIQGF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1)SCC(=O)C3=CC=CN3 |
Computed by PubChem (NCBI)