CAS 501357-54-6 is the registry number for 2-(1H-Indol-3-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1H-indol-3-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide (CAS 501357-54-6) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 2-(1H-indol-3-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide. InChIKey: SIURRCDDZKIAAN-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| InChIKey | SIURRCDDZKIAAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)NC3=NN=CS3 |
Computed by PubChem (NCBI)