CAS 901273-03-8 is the registry number for 3-(4-Methoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazine-6-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-methoxyphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione (CAS 901273-03-8) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 3-(4-methoxyphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione. InChIKey: COJVYSKLPBQXLU-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione |
| InChIKey | COJVYSKLPBQXLU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C3N2NC(=S)C=C3 |
Computed by PubChem (NCBI)