CAS 491581-72-7 is the registry number for 6-(2-Aminophenyl)-3-methyl-7h-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(2-aminophenyl)-3-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one (CAS 491581-72-7) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 6-(2-aminophenyl)-3-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one. InChIKey: UQCMJGBPQQMKIO-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 6-(2-aminophenyl)-3-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one |
| InChIKey | UQCMJGBPQQMKIO-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=NC(=O)C(=NN12)C3=CC=CC=C3N |
Computed by PubChem (NCBI)