CAS 1031927-99-7 is the registry number for 2,6-Dichloro-3-ethylquinoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-3-ethylquinoline (CAS 1031927-99-7) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 2,6-dichloro-3-ethylquinoline. InChIKey: TXFBXNIYHNTZSB-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,6-dichloro-3-ethylquinoline |
| InChIKey | TXFBXNIYHNTZSB-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C2C=CC(=CC2=C1)Cl)Cl |
Computed by PubChem (NCBI)