CAS 1150271-19-4 is the registry number for 1,3-Dichloro-6-ethylisoquinoline, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1,3-dichloro-6-ethylisoquinoline (CAS 1150271-19-4) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 1,3-dichloro-6-ethylisoquinoline. InChIKey: ULIDIEBBNZJOLG-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 1,3-dichloro-6-ethylisoquinoline |
| InChIKey | ULIDIEBBNZJOLG-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=CC(=NC(=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)