CAS 203626-46-4 appears in our catalog under these names: 4,8-Dichloro-2,6-dimethylquinoline, 95%, 4,8-Dichloro-2,6-dimethylquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4,8-dichloro-2,6-dimethylquinoline (CAS 203626-46-4) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 4,8-dichloro-2,6-dimethylquinoline. InChIKey: NVWVMGFHRHLJGD-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 4,8-dichloro-2,6-dimethylquinoline |
| InChIKey | NVWVMGFHRHLJGD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N=C2C(=C1)Cl)C)Cl |
Computed by PubChem (NCBI)