CAS 2003923-47-3 is the registry number for 2,8-Dichloro-4,5-dimethylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dichloro-4,5-dimethylquinoline (CAS 2003923-47-3) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 2,8-dichloro-4,5-dimethylquinoline. InChIKey: VUGBFKYIJYWRBA-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,8-dichloro-4,5-dimethylquinoline |
| InChIKey | VUGBFKYIJYWRBA-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=NC2=C(C=C1)Cl)Cl)C |
Computed by PubChem (NCBI)