CAS 21629-51-6 appears in our catalog under these names: 4,6-Dichloro-2,8-dimethylquinoline, 95%, 4,6-Dichloro-2,8-dimethylquinoline, 97%, 4,6-Dichloro-2,8-dimethylquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
4,6-dichloro-2,8-dimethylquinoline (CAS 21629-51-6) is a chemical compound with the molecular formula C11H9Cl2N and a molecular weight of 226.10 g/mol. IUPAC name: 4,6-dichloro-2,8-dimethylquinoline. InChIKey: CPJUQQYVCLNEHM-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 4,6-dichloro-2,8-dimethylquinoline |
| InChIKey | CPJUQQYVCLNEHM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C(C=C(N=C12)C)Cl)Cl |
Computed by PubChem (NCBI)