Products 1031929-10-8
CAS 1031929-10-8 appears in our catalog under these names: 3-Bromo-5-(trifluoromethoxy)benzyl bromide, 95%, 3-Bromo-5-(trifluoromethoxy)benzyl bromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
1-bromo-3-(bromomethyl)-5-(trifluoromethoxy)benzene (CAS 1031929-10-8) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1-bromo-3-(bromomethyl)-5-(trifluoromethoxy)benzene. InChIKey: QYRNFJCHQHPVTI-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1-bromo-3-(bromomethyl)-5-(trifluoromethoxy)benzene |
| InChIKey | QYRNFJCHQHPVTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)CBr |
Computed by PubChem (NCBI)