CAS 2383345-61-5 appears in our catalog under these names: 1,2-Dibromo-5-methoxy-3-(trifluoromethyl)benzene, 95%, 1,2-Dibromo-5-methoxy-3-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1,2-dibromo-5-methoxy-3-(trifluoromethyl)benzene (CAS 2383345-61-5) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1,2-dibromo-5-methoxy-3-(trifluoromethyl)benzene. InChIKey: BNWQMIDUKAWHRO-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1,2-dibromo-5-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | BNWQMIDUKAWHRO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)