CAS 1613518-82-3 is the registry number for 1-(3,5-Dibromophenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dibromophenyl)-2,2,2-trifluoroethanol (CAS 1613518-82-3) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1-(3,5-dibromophenyl)-2,2,2-trifluoroethanol. InChIKey: FTOSBTFZJNBYMP-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)-2,2,2-trifluoroethanol |
| InChIKey | FTOSBTFZJNBYMP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)