CAS 1124144-68-8 appears in our catalog under these names: 1,5-dibromo-2-methoxy-3-(trifluoromethyl)benzene, 95%, 1,5-Dibromo-2-methoxy-3-(trifluoromethyl)benzene, 98%, 1,5-Dibromo-2-methoxy-3-(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1,5-dibromo-2-methoxy-3-(trifluoromethyl)benzene (CAS 1124144-68-8) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1,5-dibromo-2-methoxy-3-(trifluoromethyl)benzene. InChIKey: OBLAOVLYRYJLOW-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1,5-dibromo-2-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | OBLAOVLYRYJLOW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)