CAS 685126-87-8 is the registry number for 4-Bromo-2-(bromomethyl)-1-(trifluoromethoxy)benzene, 98%. Offered by: AmBeed. Available pack sizes: 25g.
4-bromo-2-(bromomethyl)-1-(trifluoromethoxy)benzene (CAS 685126-87-8) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 4-bromo-2-(bromomethyl)-1-(trifluoromethoxy)benzene. InChIKey: STLDIGBRVPBGSV-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 4-bromo-2-(bromomethyl)-1-(trifluoromethoxy)benzene |
| InChIKey | STLDIGBRVPBGSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)