CAS 103204-32-6 appears in our catalog under these names: 2–methyl–2–(3–nitrophenyl)propanoic acid, 2-methyl-2-(3-nitrophenyl)propanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-methyl-2-(3-nitrophenyl)propanoic acid (CAS 103204-32-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-methyl-2-(3-nitrophenyl)propanoic acid. InChIKey: NICZEYWEIXUUKS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-methyl-2-(3-nitrophenyl)propanoic acid |
| InChIKey | NICZEYWEIXUUKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)